C7H12F2O2 — CID 118181583
(5R)-3,3-difluoro-6-hydroxy-5-methylhexan-2-one (PubChem CID 118181583) has the molecular formula C7H12F2O2 and a molecular weight of 166.17 g/mol. Its IUPAC name is (5R)-3,3-difluoro-6-hydroxy-5-methylhexan-2-one.
| Compound Name | (5R)-3,3-difluoro-6-hydroxy-5-methylhexan-2-one |
|---|---|
| PubChem CID | 118181583 |
| Molecular Formula | C7H12F2O2 |
| Molecular Weight | 166.17 g/mol |
| Exact Mass | 166.08 |
| IUPAC Name | (5R)-3,3-difluoro-6-hydroxy-5-methylhexan-2-one |
| SMILES | CC(=O)C(F)(F)C[C@@H](C)CO |
| InChI | InChI=1S/C7H12F2O2/c1-5(4-10)3-7(8,9)6(2)11/h5,10H,3-4H2,1-2H3/t5-/m1/s1 |
| InChIKey | YCJUURJLWSYKHP-RXMQYKEDSA-N |
| XLogP | 1.23 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 166.17 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |