C22H27F3N6O2 — CID 118182913
4-[[(1R,4S)-4-hydroxy-3,3-dimethylcyclohexyl]amino]-2-[2-[6-(2,2,2-trifluoroethoxy)-3-pyridinyl]ethylamino]pyrimidine-5-carbonitrile (PubChem CID 118182913) has the molecular formula C22H27F3N6O2 and a molecular weight of 464.49 g/mol. Its IUPAC name is 4-[[(1R,4S)-4-hydroxy-3,3-dimethylcyclohexyl]amino]-2-[2-[6-(2,2,2-trifluoroethoxy)-3-pyridinyl]ethylamino]pyrimidine-5-carbonitrile.
| Compound Name | 4-[[(1R,4S)-4-hydroxy-3,3-dimethylcyclohexyl]amino]-2-[2-[6-(2,2,2-trifluoroethoxy)-3-pyridinyl]ethylamino]pyrimidine-5-carbonitrile |
|---|---|
| PubChem CID | 118182913 |
| Molecular Formula | C22H27F3N6O2 |
| Molecular Weight | 464.49 g/mol |
| Exact Mass | 464.21 |
| IUPAC Name | 4-[[(1R,4S)-4-hydroxy-3,3-dimethylcyclohexyl]amino]-2-[2-[6-(2,2,2-trifluoroethoxy)-3-pyridinyl]ethylamino]pyrimidine-5-carbonitrile |
| SMILES | CC1(C)C[C@H](Nc2nc(NCCc3ccc(OCC(F)(F)F)nc3)ncc2C#N)CC[C@@H]1O |
| InChI | InChI=1S/C22H27F3N6O2/c1-21(2)9-16(4-5-17(21)32)30-19-15(10-26)12-29-20(31-19)27-8-7-14-3-6-18(28-11-14)33-13-22(23,24)25/h3,6,11-12,16-17,32H,4-5,7-9,13H2,1-2H3,(H2,27,29,30,31)/t16-,17+/m1/s1 |
| InChIKey | FWGGHQLXENXVCB-SJORKVTESA-N |
| XLogP | 3.69 |
| TPSA | 115.98 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.49 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |