C20H19F4N5O2 — CID 19967010
3-[[4-[2-[3-(1,1,2,2-tetrafluoroethoxy)anilino]pyrimidin-4-yl]-2-pyridinyl]amino]propan-1-ol (PubChem CID 19967010) has the molecular formula C20H19F4N5O2 and a molecular weight of 437.40 g/mol. Its IUPAC name is 3-[[4-[2-[3-(1,1,2,2-tetrafluoroethoxy)anilino]pyrimidin-4-yl]-2-pyridinyl]amino]propan-1-ol.
| Compound Name | 3-[[4-[2-[3-(1,1,2,2-tetrafluoroethoxy)anilino]pyrimidin-4-yl]-2-pyridinyl]amino]propan-1-ol |
|---|---|
| PubChem CID | 19967010 |
| Molecular Formula | C20H19F4N5O2 |
| Molecular Weight | 437.40 g/mol |
| Exact Mass | 437.15 |
| IUPAC Name | 3-[[4-[2-[3-(1,1,2,2-tetrafluoroethoxy)anilino]pyrimidin-4-yl]-2-pyridinyl]amino]propan-1-ol |
| SMILES | OCCCNc1cc(-c2ccnc(Nc3cccc(OC(F)(F)C(F)F)c3)n2)ccn1 |
| InChI | InChI=1S/C20H19F4N5O2/c21-18(22)20(23,24)31-15-4-1-3-14(12-15)28-19-27-9-6-16(29-19)13-5-8-26-17(11-13)25-7-2-10-30/h1,3-6,8-9,11-12,18,30H,2,7,10H2,(H,25,26)(H,27,28,29) |
| InChIKey | LZJBQFGZJIYHES-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 92.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.40 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|