C19H23N3O — CID 118183322
4-[[(1R,4R)-2-bicyclo[2.2.1]hept-5-enyl]methoxymethyl]-1-[(4-methylphenyl)methyl]triazole (PubChem CID 118183322) has the molecular formula C19H23N3O and a molecular weight of 309.41 g/mol. Its IUPAC name is 4-[[(1R,4R)-2-bicyclo[2.2.1]hept-5-enyl]methoxymethyl]-1-[(4-methylphenyl)methyl]triazole.
| Compound Name | 4-[[(1R,4R)-2-bicyclo[2.2.1]hept-5-enyl]methoxymethyl]-1-[(4-methylphenyl)methyl]triazole |
|---|---|
| PubChem CID | 118183322 |
| Molecular Formula | C19H23N3O |
| Molecular Weight | 309.41 g/mol |
| Exact Mass | 309.18 |
| IUPAC Name | 4-[[(1R,4R)-2-bicyclo[2.2.1]hept-5-enyl]methoxymethyl]-1-[(4-methylphenyl)methyl]triazole |
| SMILES | Cc1ccc(Cn2cc(COCC3C[C@@H]4C=C[C@H]3C4)nn2)cc1 |
| InChI | InChI=1S/C19H23N3O/c1-14-2-4-15(5-3-14)10-22-11-19(20-21-22)13-23-12-18-9-16-6-7-17(18)8-16/h2-7,11,16-18H,8-10,12-13H2,1H3/t16-,17+,18?/m1/s1 |
| InChIKey | ICOZCFAJTOQZSH-DVKDBIPTSA-N |
| XLogP | 3.36 |
| TPSA | 39.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.41 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|