C10H12F3NO3S — CID 11818405
N-but-3-enyl-1,1,1-trifluoro-N-(5-methylfuran-2-yl)methanesulfonamide (PubChem CID 11818405) has the molecular formula C10H12F3NO3S and a molecular weight of 283.27 g/mol. Its IUPAC name is N-but-3-enyl-1,1,1-trifluoro-N-(5-methylfuran-2-yl)methanesulfonamide.
| Compound Name | N-but-3-enyl-1,1,1-trifluoro-N-(5-methylfuran-2-yl)methanesulfonamide |
|---|---|
| PubChem CID | 11818405 |
| Molecular Formula | C10H12F3NO3S |
| Molecular Weight | 283.27 g/mol |
| Exact Mass | 283.05 |
| IUPAC Name | N-but-3-enyl-1,1,1-trifluoro-N-(5-methylfuran-2-yl)methanesulfonamide |
| SMILES | C=CCCN(c1ccc(C)o1)S(=O)(=O)C(F)(F)F |
| InChI | InChI=1S/C10H12F3NO3S/c1-3-4-7-14(9-6-5-8(2)17-9)18(15,16)10(11,12)13/h3,5-6H,1,4,7H2,2H3 |
| InChIKey | HYTVKIJXSGFQKO-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 50.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.27 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|