C17H19F2NO2 — CID 118186628
4-[(4,6-difluoro-5-methyl-3-oxo-1H-isoindol-2-yl)methyl]cyclohexane-1-carbaldehyde (PubChem CID 118186628) has the molecular formula C17H19F2NO2 and a molecular weight of 307.34 g/mol. Its IUPAC name is 4-[(4,6-difluoro-5-methyl-3-oxo-1H-isoindol-2-yl)methyl]cyclohexane-1-carbaldehyde.
| Compound Name | 4-[(4,6-difluoro-5-methyl-3-oxo-1H-isoindol-2-yl)methyl]cyclohexane-1-carbaldehyde |
|---|---|
| PubChem CID | 118186628 |
| Molecular Formula | C17H19F2NO2 |
| Molecular Weight | 307.34 g/mol |
| Exact Mass | 307.14 |
| IUPAC Name | 4-[(4,6-difluoro-5-methyl-3-oxo-1H-isoindol-2-yl)methyl]cyclohexane-1-carbaldehyde |
| SMILES | Cc1c(F)cc2c(c1F)C(=O)N(CC1CCC(C=O)CC1)C2 |
| InChI | InChI=1S/C17H19F2NO2/c1-10-14(18)6-13-8-20(17(22)15(13)16(10)19)7-11-2-4-12(9-21)5-3-11/h6,9,11-12H,2-5,7-8H2,1H3 |
| InChIKey | KIPVFZMMIQLHRM-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.34 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|