C24H23F2NO3 — CID 123334691
4-[1-(4,6-difluoro-3-oxo-5-phenylmethoxy-1H-isoindol-2-yl)ethenyl]cyclohexane-1-carbaldehyde (PubChem CID 123334691) has the molecular formula C24H23F2NO3 and a molecular weight of 411.45 g/mol. Its IUPAC name is 4-[1-(4,6-difluoro-3-oxo-5-phenylmethoxy-1H-isoindol-2-yl)ethenyl]cyclohexane-1-carbaldehyde.
| Compound Name | 4-[1-(4,6-difluoro-3-oxo-5-phenylmethoxy-1H-isoindol-2-yl)ethenyl]cyclohexane-1-carbaldehyde |
|---|---|
| PubChem CID | 123334691 |
| Molecular Formula | C24H23F2NO3 |
| Molecular Weight | 411.45 g/mol |
| Exact Mass | 411.16 |
| IUPAC Name | 4-[1-(4,6-difluoro-3-oxo-5-phenylmethoxy-1H-isoindol-2-yl)ethenyl]cyclohexane-1-carbaldehyde |
| SMILES | C=C(C1CCC(C=O)CC1)N1Cc2cc(F)c(OCc3ccccc3)c(F)c2C1=O |
| InChI | InChI=1S/C24H23F2NO3/c1-15(18-9-7-16(13-28)8-10-18)27-12-19-11-20(25)23(22(26)21(19)24(27)29)30-14-17-5-3-2-4-6-17/h2-6,11,13,16,18H,1,7-10,12,14H2 |
| InChIKey | VZZYCOIATZQSGP-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.45 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|