C29H31NO3 — CID 89497829
1-[2,4-bis(phenylmethoxy)-5-prop-1-en-2-ylphenyl]piperidine-4-carbaldehyde (PubChem CID 89497829) has the molecular formula C29H31NO3 and a molecular weight of 441.57 g/mol. Its IUPAC name is 1-[2,4-bis(phenylmethoxy)-5-prop-1-en-2-ylphenyl]piperidine-4-carbaldehyde.
| Compound Name | 1-[2,4-bis(phenylmethoxy)-5-prop-1-en-2-ylphenyl]piperidine-4-carbaldehyde |
|---|---|
| PubChem CID | 89497829 |
| Molecular Formula | C29H31NO3 |
| Molecular Weight | 441.57 g/mol |
| Exact Mass | 441.23 |
| IUPAC Name | 1-[2,4-bis(phenylmethoxy)-5-prop-1-en-2-ylphenyl]piperidine-4-carbaldehyde |
| SMILES | C=C(C)c1cc(N2CCC(C=O)CC2)c(OCc2ccccc2)cc1OCc1ccccc1 |
| InChI | InChI=1S/C29H31NO3/c1-22(2)26-17-27(30-15-13-23(19-31)14-16-30)29(33-21-25-11-7-4-8-12-25)18-28(26)32-20-24-9-5-3-6-10-24/h3-12,17-19,23H,1,13-16,20-21H2,2H3 |
| InChIKey | XJCKMYNWWPBQLJ-UHFFFAOYSA-N |
| XLogP | 6.29 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.57 |
| LogP ≤ 5 | 6.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|