C30H33NO4 — CID 123162290
1-[[2,4-bis(phenylmethoxy)-5-prop-1-en-2-ylphenyl]-hydroxymethyl]piperidine-4-carbaldehyde (PubChem CID 123162290) has the molecular formula C30H33NO4 and a molecular weight of 471.60 g/mol. Its IUPAC name is 1-[[2,4-bis(phenylmethoxy)-5-prop-1-en-2-ylphenyl]-hydroxymethyl]piperidine-4-carbaldehyde.
| Compound Name | 1-[[2,4-bis(phenylmethoxy)-5-prop-1-en-2-ylphenyl]-hydroxymethyl]piperidine-4-carbaldehyde |
|---|---|
| PubChem CID | 123162290 |
| Molecular Formula | C30H33NO4 |
| Molecular Weight | 471.60 g/mol |
| Exact Mass | 471.24 |
| IUPAC Name | 1-[[2,4-bis(phenylmethoxy)-5-prop-1-en-2-ylphenyl]-hydroxymethyl]piperidine-4-carbaldehyde |
| SMILES | C=C(C)c1cc(C(O)N2CCC(C=O)CC2)c(OCc2ccccc2)cc1OCc1ccccc1 |
| InChI | InChI=1S/C30H33NO4/c1-22(2)26-17-27(30(33)31-15-13-23(19-32)14-16-31)29(35-21-25-11-7-4-8-12-25)18-28(26)34-20-24-9-5-3-6-10-24/h3-12,17-19,23,30,33H,1,13-16,20-21H2,2H3 |
| InChIKey | LXRKLLCNOZRGPE-UHFFFAOYSA-N |
| XLogP | 5.78 |
| TPSA | 59.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.60 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|