C35H35NO5 — CID 46915921
[2,4-bis(phenylmethoxy)-5-prop-1-en-2-ylphenyl]-[5-(2-methoxyethoxy)-1,3-dihydroisoindol-2-yl]methanone (PubChem CID 46915921) has the molecular formula C35H35NO5 and a molecular weight of 549.67 g/mol. Its IUPAC name is [2,4-bis(phenylmethoxy)-5-prop-1-en-2-ylphenyl]-[5-(2-methoxyethoxy)-1,3-dihydroisoindol-2-yl]methanone.
| Compound Name | [2,4-bis(phenylmethoxy)-5-prop-1-en-2-ylphenyl]-[5-(2-methoxyethoxy)-1,3-dihydroisoindol-2-yl]methanone |
|---|---|
| PubChem CID | 46915921 |
| Molecular Formula | C35H35NO5 |
| Molecular Weight | 549.67 g/mol |
| Exact Mass | 549.25 |
| IUPAC Name | [2,4-bis(phenylmethoxy)-5-prop-1-en-2-ylphenyl]-[5-(2-methoxyethoxy)-1,3-dihydroisoindol-2-yl]methanone |
| SMILES | C=C(C)c1cc(C(=O)N2Cc3ccc(OCCOC)cc3C2)c(OCc2ccccc2)cc1OCc1ccccc1 |
| InChI | InChI=1S/C35H35NO5/c1-25(2)31-19-32(35(37)36-21-28-14-15-30(18-29(28)22-36)39-17-16-38-3)34(41-24-27-12-8-5-9-13-27)20-33(31)40-23-26-10-6-4-7-11-26/h4-15,18-20H,1,16-17,21-24H2,2-3H3 |
| InChIKey | NPJBDGKDYHDPHT-UHFFFAOYSA-N |
| XLogP | 7.06 |
| TPSA | 57.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.67 |
| LogP ≤ 5 | 7.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|