C38H33NO10S2 — CID 171063622
methyl 2-[2,4-bis(benzylsulfonyloxy)-6-phenylmethoxybenzoyl]-1,3-dihydroisoindole-5-carboxylate (PubChem CID 171063622) has the molecular formula C38H33NO10S2 and a molecular weight of 727.81 g/mol. Its IUPAC name is methyl 2-[2,4-bis(benzylsulfonyloxy)-6-phenylmethoxybenzoyl]-1,3-dihydroisoindole-5-carboxylate.
| Compound Name | methyl 2-[2,4-bis(benzylsulfonyloxy)-6-phenylmethoxybenzoyl]-1,3-dihydroisoindole-5-carboxylate |
|---|---|
| PubChem CID | 171063622 |
| Molecular Formula | C38H33NO10S2 |
| Molecular Weight | 727.81 g/mol |
| Exact Mass | 727.15 |
| IUPAC Name | methyl 2-[2,4-bis(benzylsulfonyloxy)-6-phenylmethoxybenzoyl]-1,3-dihydroisoindole-5-carboxylate |
| SMILES | COC(=O)c1ccc2c(c1)CN(C(=O)c1c(OCc3ccccc3)cc(OS(=O)(=O)Cc3ccccc3)cc1OS(=O)(=O)Cc1ccccc1)C2 |
| InChI | InChI=1S/C38H33NO10S2/c1-46-38(41)30-17-18-31-22-39(23-32(31)19-30)37(40)36-34(47-24-27-11-5-2-6-12-27)20-33(48-50(42,43)25-28-13-7-3-8-14-28)21-35(36)49-51(44,45)26-29-15-9-4-10-16-29/h2-21H,22-26H2,1H3 |
| InChIKey | XQNLUJDNTUIHCL-UHFFFAOYSA-N |
| XLogP | 6.03 |
| TPSA | 142.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 727.81 |
| LogP ≤ 5 | 6.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|