C31H40Cl2O6 — CID 157283088
benzyl 4-formylcyclohexane-1-carboxylate;benzyl 4-(hydroxymethyl)cyclohexane-1-carboxylate;dichloromethane (PubChem CID 157283088) has the molecular formula C31H40Cl2O6 and a molecular weight of 579.56 g/mol. Its IUPAC name is benzyl 4-formylcyclohexane-1-carboxylate;benzyl 4-(hydroxymethyl)cyclohexane-1-carboxylate;dichloromethane.
| Compound Name | benzyl 4-formylcyclohexane-1-carboxylate;benzyl 4-(hydroxymethyl)cyclohexane-1-carboxylate;dichloromethane |
|---|---|
| PubChem CID | 157283088 |
| Molecular Formula | C31H40Cl2O6 |
| Molecular Weight | 579.56 g/mol |
| Exact Mass | 578.22 |
| IUPAC Name | benzyl 4-formylcyclohexane-1-carboxylate;benzyl 4-(hydroxymethyl)cyclohexane-1-carboxylate;dichloromethane |
| SMILES | ClCCl.O=C(OCc1ccccc1)C1CCC(CO)CC1.O=CC1CCC(C(=O)OCc2ccccc2)CC1 |
| InChI | InChI=1S/C15H20O3.C15H18O3.CH2Cl2/c2*16-10-12-6-8-14(9-7-12)15(17)18-11-13-4-2-1-3-5-13;2-1-3/h1-5,12,14,16H,6-11H2;1-5,10,12,14H,6-9,11H2;1H2 |
| InChIKey | AZXFVNJSFQAGNQ-UHFFFAOYSA-N |
| XLogP | 6.69 |
| TPSA | 89.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 579.56 |
| LogP ≤ 5 | 6.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|