C35H42Cl2F2O5 — CID 161042515
benzyl 4-[(E)-3,3-difluoroprop-1-enyl]cyclohexane-1-carboxylate;benzyl 4-[(E)-3-oxoprop-1-enyl]cyclohexane-1-carboxylate;dichloromethane (PubChem CID 161042515) has the molecular formula C35H42Cl2F2O5 and a molecular weight of 651.62 g/mol. Its IUPAC name is benzyl 4-[(E)-3,3-difluoroprop-1-enyl]cyclohexane-1-carboxylate;benzyl 4-[(E)-3-oxoprop-1-enyl]cyclohexane-1-carboxylate;dichloromethane.
| Compound Name | benzyl 4-[(E)-3,3-difluoroprop-1-enyl]cyclohexane-1-carboxylate;benzyl 4-[(E)-3-oxoprop-1-enyl]cyclohexane-1-carboxylate;dichloromethane |
|---|---|
| PubChem CID | 161042515 |
| Molecular Formula | C35H42Cl2F2O5 |
| Molecular Weight | 651.62 g/mol |
| Exact Mass | 650.24 |
| IUPAC Name | benzyl 4-[(E)-3,3-difluoroprop-1-enyl]cyclohexane-1-carboxylate;benzyl 4-[(E)-3-oxoprop-1-enyl]cyclohexane-1-carboxylate;dichloromethane |
| SMILES | ClCCl.O=C(OCc1ccccc1)C1CCC(/C=C/C(F)F)CC1.O=C/C=C/C1CCC(C(=O)OCc2ccccc2)CC1 |
| InChI | InChI=1S/C17H20F2O2.C17H20O3.CH2Cl2/c18-16(19)11-8-13-6-9-15(10-7-13)17(20)21-12-14-4-2-1-3-5-14;18-12-4-7-14-8-10-16(11-9-14)17(19)20-13-15-5-2-1-3-6-15;2-1-3/h1-5,8,11,13,15-16H,6-7,9-10,12H2;1-7,12,14,16H,8-11,13H2;1H2/b11-8+;7-4+; |
| InChIKey | UBBIGCXTICOUGI-QMNUOOTDSA-N |
| XLogP | 9.07 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 651.62 |
| LogP ≤ 5 | 9.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|