C16H15BrN2O3 — CID 118187430
(2R)-4-benzyl-2-(bromomethyl)-6-nitro-2,3-dihydro-1,4-benzoxazine (PubChem CID 118187430) has the molecular formula C16H15BrN2O3 and a molecular weight of 363.21 g/mol. Its IUPAC name is (2R)-4-benzyl-2-(bromomethyl)-6-nitro-2,3-dihydro-1,4-benzoxazine.
| Compound Name | (2R)-4-benzyl-2-(bromomethyl)-6-nitro-2,3-dihydro-1,4-benzoxazine |
|---|---|
| PubChem CID | 118187430 |
| Molecular Formula | C16H15BrN2O3 |
| Molecular Weight | 363.21 g/mol |
| Exact Mass | 362.03 |
| IUPAC Name | (2R)-4-benzyl-2-(bromomethyl)-6-nitro-2,3-dihydro-1,4-benzoxazine |
| SMILES | O=[N+]([O-])c1ccc2c(c1)N(Cc1ccccc1)C[C@H](CBr)O2 |
| InChI | InChI=1S/C16H15BrN2O3/c17-9-14-11-18(10-12-4-2-1-3-5-12)15-8-13(19(20)21)6-7-16(15)22-14/h1-8,14H,9-11H2/t14-/m0/s1 |
| InChIKey | GUZDEQAMBSFTCF-AWEZNQCLSA-N |
| XLogP | 3.76 |
| TPSA | 55.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.21 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|