C28H29N5O5S — CID 118188875
3-[3-[[(4R)-8-cyano-4-methyl-1,1-dioxo-3,4,8,9-tetrahydro-5,1λ6,2-benzoxathiazepin-2-yl]methyl]-4-methylphenyl]-3-(1-methylbenzotriazol-5-yl)propanoic acid (PubChem CID 118188875) has the molecular formula C28H29N5O5S and a molecular weight of 547.64 g/mol. Its IUPAC name is 3-[3-[[(4R)-8-cyano-4-methyl-1,1-dioxo-3,4,8,9-tetrahydro-5,1λ6,2-benzoxathiazepin-2-yl]methyl]-4-methylphenyl]-3-(1-methylbenzotriazol-5-yl)propanoic acid.
| Compound Name | 3-[3-[[(4R)-8-cyano-4-methyl-1,1-dioxo-3,4,8,9-tetrahydro-5,1λ6,2-benzoxathiazepin-2-yl]methyl]-4-methylphenyl]-3-(1-methylbenzotriazol-5-yl)propanoic acid |
|---|---|
| PubChem CID | 118188875 |
| Molecular Formula | C28H29N5O5S |
| Molecular Weight | 547.64 g/mol |
| Exact Mass | 547.19 |
| IUPAC Name | 3-[3-[[(4R)-8-cyano-4-methyl-1,1-dioxo-3,4,8,9-tetrahydro-5,1λ6,2-benzoxathiazepin-2-yl]methyl]-4-methylphenyl]-3-(1-methylbenzotriazol-5-yl)propanoic acid |
| SMILES | Cc1ccc(C(CC(=O)O)c2ccc3c(c2)nnn3C)cc1CN1C[C@@H](C)OC2=C(CC(C#N)C=C2)S1(=O)=O |
| InChI | InChI=1S/C28H29N5O5S/c1-17-4-6-20(23(13-28(34)35)21-7-8-25-24(12-21)30-31-32(25)3)11-22(17)16-33-15-18(2)38-26-9-5-19(14-29)10-27(26)39(33,36)37/h4-9,11-12,18-19,23H,10,13,15-16H2,1-3H3,(H,34,35)/t18-,19?,23?/m1/s1 |
| InChIKey | CZTZJYZUAGOZSD-MVBMGLOESA-N |
| XLogP | 3.75 |
| TPSA | 138.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.64 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |