C17H16FN3O — CID 118190035
4-[3-(3-fluorophenyl)-1H-pyrrolo[2,3-b]pyridin-4-yl]morpholine (PubChem CID 118190035) has the molecular formula C17H16FN3O and a molecular weight of 297.33 g/mol. Its IUPAC name is 4-[3-(3-fluorophenyl)-1H-pyrrolo[2,3-b]pyridin-4-yl]morpholine.
| Compound Name | 4-[3-(3-fluorophenyl)-1H-pyrrolo[2,3-b]pyridin-4-yl]morpholine |
|---|---|
| PubChem CID | 118190035 |
| Molecular Formula | C17H16FN3O |
| Molecular Weight | 297.33 g/mol |
| Exact Mass | 297.13 |
| IUPAC Name | 4-[3-(3-fluorophenyl)-1H-pyrrolo[2,3-b]pyridin-4-yl]morpholine |
| SMILES | Fc1cccc(-c2c[nH]c3nccc(N4CCOCC4)c23)c1 |
| InChI | InChI=1S/C17H16FN3O/c18-13-3-1-2-12(10-13)14-11-20-17-16(14)15(4-5-19-17)21-6-8-22-9-7-21/h1-5,10-11H,6-9H2,(H,19,20) |
| InChIKey | YMVBJXNDQZKZLG-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 41.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.33 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |