C18H23FN4S — CID 118190313
N-[(3-fluorophenyl)methyl]-N-methyl-1-(2-methylsulfanylpyrimidin-4-yl)piperidin-4-amine (PubChem CID 118190313) has the molecular formula C18H23FN4S and a molecular weight of 346.48 g/mol. Its IUPAC name is N-[(3-fluorophenyl)methyl]-N-methyl-1-(2-methylsulfanylpyrimidin-4-yl)piperidin-4-amine.
| Compound Name | N-[(3-fluorophenyl)methyl]-N-methyl-1-(2-methylsulfanylpyrimidin-4-yl)piperidin-4-amine |
|---|---|
| PubChem CID | 118190313 |
| Molecular Formula | C18H23FN4S |
| Molecular Weight | 346.48 g/mol |
| Exact Mass | 346.16 |
| IUPAC Name | N-[(3-fluorophenyl)methyl]-N-methyl-1-(2-methylsulfanylpyrimidin-4-yl)piperidin-4-amine |
| SMILES | CSc1nccc(N2CCC(N(C)Cc3cccc(F)c3)CC2)n1 |
| InChI | InChI=1S/C18H23FN4S/c1-22(13-14-4-3-5-15(19)12-14)16-7-10-23(11-8-16)17-6-9-20-18(21-17)24-2/h3-6,9,12,16H,7-8,10-11,13H2,1-2H3 |
| InChIKey | URWJCZMWNWXGOG-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 32.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.48 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |