C16H14F2N6 — CID 49857681
US9205085, Msx-193 (PubChem CID 49857681) has the molecular formula C16H14F2N6 and a molecular weight of 328.32 g/mol. Its IUPAC name is 2-fluoro-N-[[4-[[(2-fluoropyrimidin-4-yl)amino]methyl]phenyl]methyl]pyrimidin-4-amine.
| Compound Name | US9205085, Msx-193 |
|---|---|
| PubChem CID | 49857681 |
| Molecular Formula | C16H14F2N6 |
| Molecular Weight | 328.32 g/mol |
| Exact Mass | 328.12 |
| IUPAC Name | 2-fluoro-N-[[4-[[(2-fluoropyrimidin-4-yl)amino]methyl]phenyl]methyl]pyrimidin-4-amine |
| SMILES | C1=CC(=CC=C1CNC2=NC(=NC=C2)F)CNC3=NC(=NC=C3)F |
| InChI | InChI=1S/C16H14F2N6/c17-15-19-7-5-13(23-15)21-9-11-1-2-12(4-3-11)10-22-14-6-8-20-16(18)24-14/h1-8H,9-10H2,(H,19,21,23)(H,20,22,24) |
| InChIKey | ZDXKEURYGUEZLY-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 75.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | 332 |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.32 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |