C13H13Cl2FN6 — CID 118190438
6-(2,3-dichloro-5-fluorophenyl)-3-piperazin-1-yl-1,2,4-triazin-5-amine (PubChem CID 118190438) has the molecular formula C13H13Cl2FN6 and a molecular weight of 343.19 g/mol. Its IUPAC name is 6-(2,3-dichloro-5-fluorophenyl)-3-piperazin-1-yl-1,2,4-triazin-5-amine.
| Compound Name | 6-(2,3-dichloro-5-fluorophenyl)-3-piperazin-1-yl-1,2,4-triazin-5-amine |
|---|---|
| PubChem CID | 118190438 |
| Molecular Formula | C13H13Cl2FN6 |
| Molecular Weight | 343.19 g/mol |
| Exact Mass | 342.06 |
| IUPAC Name | 6-(2,3-dichloro-5-fluorophenyl)-3-piperazin-1-yl-1,2,4-triazin-5-amine |
| SMILES | Nc1nc(N2CCNCC2)nnc1-c1cc(F)cc(Cl)c1Cl |
| InChI | InChI=1S/C13H13Cl2FN6/c14-9-6-7(16)5-8(10(9)15)11-12(17)19-13(21-20-11)22-3-1-18-2-4-22/h5-6,18H,1-4H2,(H2,17,19,21) |
| InChIKey | NBTQDNGGYVDHGN-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 79.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.19 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|