C26H21NO3 — CID 118191081
2,4-dimethyl-3-[(3-phenylnaphthalene-1-carbonyl)amino]benzoic acid (PubChem CID 118191081) has the molecular formula C26H21NO3 and a molecular weight of 395.46 g/mol. Its IUPAC name is 2,4-dimethyl-3-[(3-phenylnaphthalene-1-carbonyl)amino]benzoic acid.
| Compound Name | 2,4-dimethyl-3-[(3-phenylnaphthalene-1-carbonyl)amino]benzoic acid |
|---|---|
| PubChem CID | 118191081 |
| Molecular Formula | C26H21NO3 |
| Molecular Weight | 395.46 g/mol |
| Exact Mass | 395.15 |
| IUPAC Name | 2,4-dimethyl-3-[(3-phenylnaphthalene-1-carbonyl)amino]benzoic acid |
| SMILES | Cc1ccc(C(=O)O)c(C)c1NC(=O)c1cc(-c2ccccc2)cc2ccccc12 |
| InChI | InChI=1S/C26H21NO3/c1-16-12-13-21(26(29)30)17(2)24(16)27-25(28)23-15-20(18-8-4-3-5-9-18)14-19-10-6-7-11-22(19)23/h3-15H,1-2H3,(H,27,28)(H,29,30) |
| InChIKey | DAKJLCAYRKDWAQ-UHFFFAOYSA-N |
| XLogP | 6.07 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.46 |
| LogP ≤ 5 | 6.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |