C25H28F4N2O8S — CID 118191916
(2R)-2-[[(2S)-4-(4-fluoro-3-methoxyphenyl)sulfonyl-6-[(1,1,1-trifluoro-2-methylpropan-2-yl)oxycarbonylamino]-2,3-dihydro-1,4-benzoxazin-2-yl]methyl]butanoic acid (PubChem CID 118191916) has the molecular formula C25H28F4N2O8S and a molecular weight of 592.56 g/mol. Its IUPAC name is (2R)-2-[[(2S)-4-(4-fluoro-3-methoxyphenyl)sulfonyl-6-[(1,1,1-trifluoro-2-methylpropan-2-yl)oxycarbonylamino]-2,3-dihydro-1,4-benzoxazin-2-yl]methyl]butanoic acid.
| Compound Name | (2R)-2-[[(2S)-4-(4-fluoro-3-methoxyphenyl)sulfonyl-6-[(1,1,1-trifluoro-2-methylpropan-2-yl)oxycarbonylamino]-2,3-dihydro-1,4-benzoxazin-2-yl]methyl]butanoic acid |
|---|---|
| PubChem CID | 118191916 |
| Molecular Formula | C25H28F4N2O8S |
| Molecular Weight | 592.56 g/mol |
| Exact Mass | 592.15 |
| IUPAC Name | (2R)-2-[[(2S)-4-(4-fluoro-3-methoxyphenyl)sulfonyl-6-[(1,1,1-trifluoro-2-methylpropan-2-yl)oxycarbonylamino]-2,3-dihydro-1,4-benzoxazin-2-yl]methyl]butanoic acid |
| SMILES | CC[C@H](C[C@H]1CN(S(=O)(=O)c2ccc(F)c(OC)c2)c2cc(NC(=O)OC(C)(C)C(F)(F)F)ccc2O1)C(=O)O |
| InChI | InChI=1S/C25H28F4N2O8S/c1-5-14(22(32)33)10-16-13-31(40(35,36)17-7-8-18(26)21(12-17)37-4)19-11-15(6-9-20(19)38-16)30-23(34)39-24(2,3)25(27,28)29/h6-9,11-12,14,16H,5,10,13H2,1-4H3,(H,30,34)(H,32,33)/t14-,16+/m1/s1 |
| InChIKey | QYQJXQYFEDVHQZ-ZBFHGGJFSA-N |
| XLogP | 5.18 |
| TPSA | 131.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 592.56 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |