C26H28F4N2O7S — CID 122638090
2-cyclopropyl-3-[4-(4-fluoro-3-methylphenyl)sulfonyl-6-[(1,1,1-trifluoro-2-methylpropan-2-yl)oxycarbonylamino]-2,3-dihydro-1,4-benzoxazin-2-yl]propanoic acid (PubChem CID 122638090) has the molecular formula C26H28F4N2O7S and a molecular weight of 588.58 g/mol. Its IUPAC name is 2-cyclopropyl-3-[4-(4-fluoro-3-methylphenyl)sulfonyl-6-[(1,1,1-trifluoro-2-methylpropan-2-yl)oxycarbonylamino]-2,3-dihydro-1,4-benzoxazin-2-yl]propanoic acid.
| Compound Name | 2-cyclopropyl-3-[4-(4-fluoro-3-methylphenyl)sulfonyl-6-[(1,1,1-trifluoro-2-methylpropan-2-yl)oxycarbonylamino]-2,3-dihydro-1,4-benzoxazin-2-yl]propanoic acid |
|---|---|
| PubChem CID | 122638090 |
| Molecular Formula | C26H28F4N2O7S |
| Molecular Weight | 588.58 g/mol |
| Exact Mass | 588.16 |
| IUPAC Name | 2-cyclopropyl-3-[4-(4-fluoro-3-methylphenyl)sulfonyl-6-[(1,1,1-trifluoro-2-methylpropan-2-yl)oxycarbonylamino]-2,3-dihydro-1,4-benzoxazin-2-yl]propanoic acid |
| SMILES | Cc1cc(S(=O)(=O)N2CC(CC(C(=O)O)C3CC3)Oc3ccc(NC(=O)OC(C)(C)C(F)(F)F)cc32)ccc1F |
| InChI | InChI=1S/C26H28F4N2O7S/c1-14-10-18(7-8-20(14)27)40(36,37)32-13-17(12-19(23(33)34)15-4-5-15)38-22-9-6-16(11-21(22)32)31-24(35)39-25(2,3)26(28,29)30/h6-11,15,17,19H,4-5,12-13H2,1-3H3,(H,31,35)(H,33,34) |
| InChIKey | YMEOMYKPWVCGQY-UHFFFAOYSA-N |
| XLogP | 5.48 |
| TPSA | 122.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 588.58 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |