C25H26F4N2O7S — CID 118191914
3-[(2S)-4-(3-cyclopropyl-4-fluorophenyl)sulfonyl-6-[(1,1,1-trifluoro-2-methylpropan-2-yl)oxycarbonylamino]-2,3-dihydro-1,4-benzoxazin-2-yl]propanoic acid (PubChem CID 118191914) has the molecular formula C25H26F4N2O7S and a molecular weight of 574.55 g/mol. Its IUPAC name is 3-[(2S)-4-(3-cyclopropyl-4-fluorophenyl)sulfonyl-6-[(1,1,1-trifluoro-2-methylpropan-2-yl)oxycarbonylamino]-2,3-dihydro-1,4-benzoxazin-2-yl]propanoic acid.
| Compound Name | 3-[(2S)-4-(3-cyclopropyl-4-fluorophenyl)sulfonyl-6-[(1,1,1-trifluoro-2-methylpropan-2-yl)oxycarbonylamino]-2,3-dihydro-1,4-benzoxazin-2-yl]propanoic acid |
|---|---|
| PubChem CID | 118191914 |
| Molecular Formula | C25H26F4N2O7S |
| Molecular Weight | 574.55 g/mol |
| Exact Mass | 574.14 |
| IUPAC Name | 3-[(2S)-4-(3-cyclopropyl-4-fluorophenyl)sulfonyl-6-[(1,1,1-trifluoro-2-methylpropan-2-yl)oxycarbonylamino]-2,3-dihydro-1,4-benzoxazin-2-yl]propanoic acid |
| SMILES | CC(C)(OC(=O)Nc1ccc2c(c1)N(S(=O)(=O)c1ccc(F)c(C3CC3)c1)C[C@H](CCC(=O)O)O2)C(F)(F)F |
| InChI | InChI=1S/C25H26F4N2O7S/c1-24(2,25(27,28)29)38-23(34)30-15-5-9-21-20(11-15)31(13-16(37-21)6-10-22(32)33)39(35,36)17-7-8-19(26)18(12-17)14-3-4-14/h5,7-9,11-12,14,16H,3-4,6,10,13H2,1-2H3,(H,30,34)(H,32,33)/t16-/m0/s1 |
| InChIKey | BCHZKRMDRHRBPM-INIZCTEOSA-N |
| XLogP | 5.41 |
| TPSA | 122.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.55 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |