C23H24ClF3N2O8S — CID 122637948
3-[4-(2-chloro-5-methoxyphenyl)sulfonyl-6-[(1,1,1-trifluoro-2-methylpropan-2-yl)oxycarbonylamino]-2,3-dihydro-1,4-benzoxazin-2-yl]propanoic acid (PubChem CID 122637948) has the molecular formula C23H24ClF3N2O8S and a molecular weight of 580.97 g/mol. Its IUPAC name is 3-[4-(2-chloro-5-methoxyphenyl)sulfonyl-6-[(1,1,1-trifluoro-2-methylpropan-2-yl)oxycarbonylamino]-2,3-dihydro-1,4-benzoxazin-2-yl]propanoic acid.
| Compound Name | 3-[4-(2-chloro-5-methoxyphenyl)sulfonyl-6-[(1,1,1-trifluoro-2-methylpropan-2-yl)oxycarbonylamino]-2,3-dihydro-1,4-benzoxazin-2-yl]propanoic acid |
|---|---|
| PubChem CID | 122637948 |
| Molecular Formula | C23H24ClF3N2O8S |
| Molecular Weight | 580.97 g/mol |
| Exact Mass | 580.09 |
| IUPAC Name | 3-[4-(2-chloro-5-methoxyphenyl)sulfonyl-6-[(1,1,1-trifluoro-2-methylpropan-2-yl)oxycarbonylamino]-2,3-dihydro-1,4-benzoxazin-2-yl]propanoic acid |
| SMILES | COc1ccc(Cl)c(S(=O)(=O)N2CC(CCC(=O)O)Oc3ccc(NC(=O)OC(C)(C)C(F)(F)F)cc32)c1 |
| InChI | InChI=1S/C23H24ClF3N2O8S/c1-22(2,23(25,26)27)37-21(32)28-13-4-8-18-17(10-13)29(12-15(36-18)6-9-20(30)31)38(33,34)19-11-14(35-3)5-7-16(19)24/h4-5,7-8,10-11,15H,6,9,12H2,1-3H3,(H,28,32)(H,30,31) |
| InChIKey | ILLYKAUPIZQRTR-UHFFFAOYSA-N |
| XLogP | 5.06 |
| TPSA | 131.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.97 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |