C11H20N2O4 — CID 118192935
tert-butyl N-(5-hydroxypiperidine-2-carbonyl)carbamate (PubChem CID 118192935) has the molecular formula C11H20N2O4 and a molecular weight of 244.29 g/mol. Its IUPAC name is tert-butyl N-(5-hydroxypiperidine-2-carbonyl)carbamate.
| Compound Name | tert-butyl N-(5-hydroxypiperidine-2-carbonyl)carbamate |
|---|---|
| PubChem CID | 118192935 |
| Molecular Formula | C11H20N2O4 |
| Molecular Weight | 244.29 g/mol |
| Exact Mass | 244.14 |
| IUPAC Name | tert-butyl N-(5-hydroxypiperidine-2-carbonyl)carbamate |
| SMILES | CC(C)(C)OC(=O)NC(=O)C1CCC(O)CN1 |
| InChI | InChI=1S/C11H20N2O4/c1-11(2,3)17-10(16)13-9(15)8-5-4-7(14)6-12-8/h7-8,12,14H,4-6H2,1-3H3,(H,13,15,16) |
| InChIKey | BVMJKMRWCGUKTO-UHFFFAOYSA-N |
| XLogP | 0.15 |
| TPSA | 87.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.29 |
| LogP ≤ 5 | 0.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |