About propyl pyridine-3-carboximidate
propyl pyridine-3-carboximidate (PubChem CID 11819373) has the molecular formula C9H12N2O
and a molecular weight of 164.21 g/mol. Its IUPAC name is propyl pyridine-3-carboximidate.
Molecular Properties
| Compound Name | propyl pyridine-3-carboximidate |
| PubChem CID | 11819373 |
| Molecular Formula | C9H12N2O |
| Molecular Weight | 164.21 g/mol |
| Exact Mass | 164.09 |
| IUPAC Name | propyl pyridine-3-carboximidate |
| SMILES | [H]/N=C(\OCCC)c1cccnc1 |
| InChI | InChI=1S/C9H12N2O/c1-2-6-12-9(10)8-4-3-5-11-7-8/h3-5,7,10H,2,6H2,1H3/b10-9- |
| InChIKey | JJJRVXVHMCAYLB-KTKRTIGZSA-N |
| XLogP | 1.83 |
| TPSA | 45.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 164.21 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze propyl pyridine-3-carboximidate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of propyl pyridine-3-carboximidate?
The IUPAC name of propyl pyridine-3-carboximidate (CID 11819373) is propyl pyridine-3-carboximidate.
What is the SMILES notation for propyl pyridine-3-carboximidate?
The canonical SMILES for propyl pyridine-3-carboximidate is [H]/N=C(\OCCC)c1cccnc1.
What is the InChIKey of propyl pyridine-3-carboximidate?
The InChIKey is JJJRVXVHMCAYLB-KTKRTIGZSA-N. The full InChI is InChI=1S/C9H12N2O/c1-2-6-12-9(10)8-4-3-5-11-7-8/h3-5,7,10H,2,6H2,1H3/b10-9-.
What are the key properties of propyl pyridine-3-carboximidate?
propyl pyridine-3-carboximidate has a molecular weight of 164.21 g/mol, XLogP of 1.83, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for propyl pyridine-3-carboximidate is sourced from PubChem (CID 11819373), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).