About cyano pyridine-3-carboximidate
cyano pyridine-3-carboximidate (PubChem CID 19734521) has the molecular formula C7H5N3O
and a molecular weight of 147.14 g/mol. Its IUPAC name is cyano pyridine-3-carboximidate.
Molecular Properties
| Compound Name | cyano pyridine-3-carboximidate |
| PubChem CID | 19734521 |
| Molecular Formula | C7H5N3O |
| Molecular Weight | 147.14 g/mol |
| Exact Mass | 147.04 |
| IUPAC Name | cyano pyridine-3-carboximidate |
| SMILES | [H]/N=C(\OC#N)c1cccnc1 |
| InChI | InChI=1S/C7H5N3O/c8-5-11-7(9)6-2-1-3-10-4-6/h1-4,9H/b9-7- |
| InChIKey | PAERFZUWMHYRDH-CLFYSBASSA-N |
| XLogP | 0.90 |
| TPSA | 69.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 147.14 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze cyano pyridine-3-carboximidate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cyano pyridine-3-carboximidate?
The IUPAC name of cyano pyridine-3-carboximidate (CID 19734521) is cyano pyridine-3-carboximidate.
What is the SMILES notation for cyano pyridine-3-carboximidate?
The canonical SMILES for cyano pyridine-3-carboximidate is [H]/N=C(\OC#N)c1cccnc1.
What is the InChIKey of cyano pyridine-3-carboximidate?
The InChIKey is PAERFZUWMHYRDH-CLFYSBASSA-N. The full InChI is InChI=1S/C7H5N3O/c8-5-11-7(9)6-2-1-3-10-4-6/h1-4,9H/b9-7-.
What are the key properties of cyano pyridine-3-carboximidate?
cyano pyridine-3-carboximidate has a molecular weight of 147.14 g/mol, XLogP of 0.90, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for cyano pyridine-3-carboximidate is sourced from PubChem (CID 19734521), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).