C32H24N6O3 — CID 146558563
[4-[(E)-2-[3,5-bis(pyridine-3-carboximidoyloxy)phenyl]ethenyl]phenyl] pyridine-3-carboximidate (PubChem CID 146558563) has the molecular formula C32H24N6O3 and a molecular weight of 540.58 g/mol. Its IUPAC name is [4-[(E)-2-[3,5-bis(pyridine-3-carboximidoyloxy)phenyl]ethenyl]phenyl] pyridine-3-carboximidate.
| Compound Name | [4-[(E)-2-[3,5-bis(pyridine-3-carboximidoyloxy)phenyl]ethenyl]phenyl] pyridine-3-carboximidate |
|---|---|
| PubChem CID | 146558563 |
| Molecular Formula | C32H24N6O3 |
| Molecular Weight | 540.58 g/mol |
| Exact Mass | 540.19 |
| IUPAC Name | [4-[(E)-2-[3,5-bis(pyridine-3-carboximidoyloxy)phenyl]ethenyl]phenyl] pyridine-3-carboximidate |
| SMILES | [H]/N=C(/Oc1ccc(/C=C/c2cc(O/C(=N/[H])c3cccnc3)cc(O/C(=N/[H])c3cccnc3)c2)cc1)c1cccnc1 |
| InChI | InChI=1S/C32H24N6O3/c33-30(24-4-1-13-36-19-24)39-27-11-9-22(10-12-27)7-8-23-16-28(40-31(34)25-5-2-14-37-20-25)18-29(17-23)41-32(35)26-6-3-15-38-21-26/h1-21,33-35H/b8-7+,33-30+,34-31+,35-32+ |
| InChIKey | KFIDAGHQQGWQDT-GFVMUPJXSA-N |
| XLogP | 6.26 |
| TPSA | 137.91 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.58 |
| LogP ≤ 5 | 6.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|