C39H35NO9 — CID 174054814
bis[4-[2-(3,5-dimethoxyphenyl)ethenyl]phenyl] carbonate;pyridine-3-carboxylic acid (PubChem CID 174054814) has the molecular formula C39H35NO9 and a molecular weight of 661.71 g/mol. Its IUPAC name is bis[4-[2-(3,5-dimethoxyphenyl)ethenyl]phenyl] carbonate;pyridine-3-carboxylic acid.
| Compound Name | bis[4-[2-(3,5-dimethoxyphenyl)ethenyl]phenyl] carbonate;pyridine-3-carboxylic acid |
|---|---|
| PubChem CID | 174054814 |
| Molecular Formula | C39H35NO9 |
| Molecular Weight | 661.71 g/mol |
| Exact Mass | 661.23 |
| IUPAC Name | bis[4-[2-(3,5-dimethoxyphenyl)ethenyl]phenyl] carbonate;pyridine-3-carboxylic acid |
| SMILES | COc1cc(C=Cc2ccc(OC(=O)Oc3ccc(C=Cc4cc(OC)cc(OC)c4)cc3)cc2)cc(OC)c1.O=C(O)c1cccnc1 |
| InChI | InChI=1S/C33H30O7.C6H5NO2/c1-35-29-17-25(18-30(21-29)36-2)7-5-23-9-13-27(14-10-23)39-33(34)40-28-15-11-24(12-16-28)6-8-26-19-31(37-3)22-32(20-26)38-4;8-6(9)5-2-1-3-7-4-5/h5-22H,1-4H3;1-4H,(H,8,9) |
| InChIKey | DWUXNQXSHPOCBP-UHFFFAOYSA-N |
| XLogP | 8.42 |
| TPSA | 122.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 661.71 |
| LogP ≤ 5 | 8.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|