C13H17Br2NO4 — CID 118195792
(2S)-2-amino-3-[3,5-bis(2-bromoethoxy)phenyl]propanoic acid (PubChem CID 118195792) has the molecular formula C13H17Br2NO4 and a molecular weight of 411.09 g/mol. Its IUPAC name is (2S)-2-amino-3-[3,5-bis(2-bromoethoxy)phenyl]propanoic acid.
| Compound Name | (2S)-2-amino-3-[3,5-bis(2-bromoethoxy)phenyl]propanoic acid |
|---|---|
| PubChem CID | 118195792 |
| Molecular Formula | C13H17Br2NO4 |
| Molecular Weight | 411.09 g/mol |
| Exact Mass | 408.95 |
| IUPAC Name | (2S)-2-amino-3-[3,5-bis(2-bromoethoxy)phenyl]propanoic acid |
| SMILES | N[C@@H](Cc1cc(OCCBr)cc(OCCBr)c1)C(=O)O |
| InChI | InChI=1S/C13H17Br2NO4/c14-1-3-19-10-5-9(7-12(16)13(17)18)6-11(8-10)20-4-2-15/h5-6,8,12H,1-4,7,16H2,(H,17,18)/t12-/m0/s1 |
| InChIKey | VCLVBMPJCXKVPZ-LBPRGKRZSA-N |
| XLogP | 2.19 |
| TPSA | 81.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.09 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|