About (4R)-4-[4-(1,3-thiazole-2-carbonyl)piperazin-1-yl]oxolan-2-one
(4R)-4-[4-(1,3-thiazole-2-carbonyl)piperazin-1-yl]oxolan-2-one (PubChem CID 118196684) has the molecular formula C12H15N3O3S
and a molecular weight of 281.34 g/mol. Its IUPAC name is (4R)-4-[4-(1,3-thiazole-2-carbonyl)piperazin-1-yl]oxolan-2-one.
Molecular Properties
| Compound Name | (4R)-4-[4-(1,3-thiazole-2-carbonyl)piperazin-1-yl]oxolan-2-one |
| PubChem CID | 118196684 |
| Molecular Formula | C12H15N3O3S |
| Molecular Weight | 281.34 g/mol |
| Exact Mass | 281.08 |
| IUPAC Name | (4R)-4-[4-(1,3-thiazole-2-carbonyl)piperazin-1-yl]oxolan-2-one |
| SMILES | O=C1C[C@@H](N2CCN(C(=O)c3nccs3)CC2)CO1 |
| InChI | InChI=1S/C12H15N3O3S/c16-10-7-9(8-18-10)14-2-4-15(5-3-14)12(17)11-13-1-6-19-11/h1,6,9H,2-5,7-8H2/t9-/m1/s1 |
| InChIKey | IZCLWRWLXLNTMS-SECBINFHSA-N |
| XLogP | 0.22 |
| TPSA | 62.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 281.34 |
| LogP ≤ 5 | 0.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze (4R)-4-[4-(1,3-thiazole-2-carbonyl)piperazin-1-yl]oxolan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4R)-4-[4-(1,3-thiazole-2-carbonyl)piperazin-1-yl]oxolan-2-one?
The IUPAC name of (4R)-4-[4-(1,3-thiazole-2-carbonyl)piperazin-1-yl]oxolan-2-one (CID 118196684) is (4R)-4-[4-(1,3-thiazole-2-carbonyl)piperazin-1-yl]oxolan-2-one.
What is the SMILES notation for (4R)-4-[4-(1,3-thiazole-2-carbonyl)piperazin-1-yl]oxolan-2-one?
The canonical SMILES for (4R)-4-[4-(1,3-thiazole-2-carbonyl)piperazin-1-yl]oxolan-2-one is O=C1C[C@@H](N2CCN(C(=O)c3nccs3)CC2)CO1.
What is the InChIKey of (4R)-4-[4-(1,3-thiazole-2-carbonyl)piperazin-1-yl]oxolan-2-one?
The InChIKey is IZCLWRWLXLNTMS-SECBINFHSA-N. The full InChI is InChI=1S/C12H15N3O3S/c16-10-7-9(8-18-10)14-2-4-15(5-3-14)12(17)11-13-1-6-19-11/h1,6,9H,2-5,7-8H2/t9-/m1/s1.
What are the key properties of (4R)-4-[4-(1,3-thiazole-2-carbonyl)piperazin-1-yl]oxolan-2-one?
(4R)-4-[4-(1,3-thiazole-2-carbonyl)piperazin-1-yl]oxolan-2-one has a molecular weight of 281.34 g/mol, XLogP of 0.22, 2 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for (4R)-4-[4-(1,3-thiazole-2-carbonyl)piperazin-1-yl]oxolan-2-one is sourced from PubChem (CID 118196684), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).