C18H19IN4O2S — CID 118196814
1-(3-iodophenyl)-4-[4-(1,3-thiazole-4-carbonyl)piperazin-1-yl]pyrrolidin-2-one (PubChem CID 118196814) has the molecular formula C18H19IN4O2S and a molecular weight of 482.35 g/mol. Its IUPAC name is 1-(3-iodophenyl)-4-[4-(1,3-thiazole-4-carbonyl)piperazin-1-yl]pyrrolidin-2-one.
| Compound Name | 1-(3-iodophenyl)-4-[4-(1,3-thiazole-4-carbonyl)piperazin-1-yl]pyrrolidin-2-one |
|---|---|
| PubChem CID | 118196814 |
| Molecular Formula | C18H19IN4O2S |
| Molecular Weight | 482.35 g/mol |
| Exact Mass | 482.03 |
| IUPAC Name | 1-(3-iodophenyl)-4-[4-(1,3-thiazole-4-carbonyl)piperazin-1-yl]pyrrolidin-2-one |
| SMILES | O=C(c1cscn1)N1CCN(C2CC(=O)N(c3cccc(I)c3)C2)CC1 |
| InChI | InChI=1S/C18H19IN4O2S/c19-13-2-1-3-14(8-13)23-10-15(9-17(23)24)21-4-6-22(7-5-21)18(25)16-11-26-12-20-16/h1-3,8,11-12,15H,4-7,9-10H2 |
| InChIKey | LRQVFFNWVHTBDQ-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 56.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.35 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|