C32H36N2O10 — CID 118198193
1-[4-[3-[2-[3-[4-(3,4-dimethyl-2,5-dioxopyrrol-1-yl)phenoxy]-2-hydroxypropoxy]ethoxy]-2-hydroxypropoxy]phenyl]-3,4-dimethylpyrrole-2,5-dione (PubChem CID 118198193) has the molecular formula C32H36N2O10 and a molecular weight of 608.64 g/mol. Its IUPAC name is 1-[4-[3-[2-[3-[4-(3,4-dimethyl-2,5-dioxopyrrol-1-yl)phenoxy]-2-hydroxypropoxy]ethoxy]-2-hydroxypropoxy]phenyl]-3,4-dimethylpyrrole-2,5-dione.
| Compound Name | 1-[4-[3-[2-[3-[4-(3,4-dimethyl-2,5-dioxopyrrol-1-yl)phenoxy]-2-hydroxypropoxy]ethoxy]-2-hydroxypropoxy]phenyl]-3,4-dimethylpyrrole-2,5-dione |
|---|---|
| PubChem CID | 118198193 |
| Molecular Formula | C32H36N2O10 |
| Molecular Weight | 608.64 g/mol |
| Exact Mass | 608.24 |
| IUPAC Name | 1-[4-[3-[2-[3-[4-(3,4-dimethyl-2,5-dioxopyrrol-1-yl)phenoxy]-2-hydroxypropoxy]ethoxy]-2-hydroxypropoxy]phenyl]-3,4-dimethylpyrrole-2,5-dione |
| SMILES | CC1=C(C)C(=O)N(c2ccc(OCC(O)COCCOCC(O)COc3ccc(N4C(=O)C(C)=C(C)C4=O)cc3)cc2)C1=O |
| InChI | InChI=1S/C32H36N2O10/c1-19-20(2)30(38)33(29(19)37)23-5-9-27(10-6-23)43-17-25(35)15-41-13-14-42-16-26(36)18-44-28-11-7-24(8-12-28)34-31(39)21(3)22(4)32(34)40/h5-12,25-26,35-36H,13-18H2,1-4H3 |
| InChIKey | IWVVLUCQKRMJOH-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 152.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 608.64 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|