C22H19NO6 — CID 23967003
2-[4-[3-(furan-2-ylmethoxy)-2-hydroxypropoxy]phenyl]isoindole-1,3-dione (PubChem CID 23967003) has the molecular formula C22H19NO6 and a molecular weight of 393.40 g/mol. Its IUPAC name is 2-[4-[3-(furan-2-ylmethoxy)-2-hydroxypropoxy]phenyl]isoindole-1,3-dione.
| Compound Name | 2-[4-[3-(furan-2-ylmethoxy)-2-hydroxypropoxy]phenyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 23967003 |
| Molecular Formula | C22H19NO6 |
| Molecular Weight | 393.40 g/mol |
| Exact Mass | 393.12 |
| IUPAC Name | 2-[4-[3-(furan-2-ylmethoxy)-2-hydroxypropoxy]phenyl]isoindole-1,3-dione |
| SMILES | O=C1c2ccccc2C(=O)N1c1ccc(OCC(O)COCc2ccco2)cc1 |
| InChI | InChI=1S/C22H19NO6/c24-16(12-27-14-18-4-3-11-28-18)13-29-17-9-7-15(8-10-17)23-21(25)19-5-1-2-6-20(19)22(23)26/h1-11,16,24H,12-14H2 |
| InChIKey | NYIRAKUYFURLQR-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 89.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.40 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|