C17H23NO4 — CID 2110208
(2R)-1-(furan-2-ylmethoxy)-3-[methyl(2-phenoxyethyl)amino]propan-2-ol (PubChem CID 2110208) has the molecular formula C17H23NO4 and a molecular weight of 305.37 g/mol. Its IUPAC name is (2R)-1-(furan-2-ylmethoxy)-3-[methyl(2-phenoxyethyl)amino]propan-2-ol.
| Compound Name | (2R)-1-(furan-2-ylmethoxy)-3-[methyl(2-phenoxyethyl)amino]propan-2-ol |
|---|---|
| PubChem CID | 2110208 |
| Molecular Formula | C17H23NO4 |
| Molecular Weight | 305.37 g/mol |
| Exact Mass | 305.16 |
| IUPAC Name | (2R)-1-(furan-2-ylmethoxy)-3-[methyl(2-phenoxyethyl)amino]propan-2-ol |
| SMILES | CN(CCOc1ccccc1)C[C@@H](O)COCc1ccco1 |
| InChI | InChI=1S/C17H23NO4/c1-18(9-11-22-16-6-3-2-4-7-16)12-15(19)13-20-14-17-8-5-10-21-17/h2-8,10,15,19H,9,11-14H2,1H3/t15-/m1/s1 |
| InChIKey | AYWICRIVSSMBPD-OAHLLOKOSA-N |
| XLogP | 2.17 |
| TPSA | 55.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.37 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |