C32H27N3O5 — CID 118199038
6-(1-hydroxy-4-methylpentan-2-yl)-13-(N-phenylanilino)-6,13-diazatetracyclo[6.6.2.04,16.011,15]hexadeca-1(15),2,4(16),8,10-pentaene-5,7,12,14-tetrone (PubChem CID 118199038) has the molecular formula C32H27N3O5 and a molecular weight of 533.58 g/mol. Its IUPAC name is 6-(1-hydroxy-4-methylpentan-2-yl)-13-(N-phenylanilino)-6,13-diazatetracyclo[6.6.2.04,16.011,15]hexadeca-1(15),2,4(16),8,10-pentaene-5,7,12,14-tetrone.
| Compound Name | 6-(1-hydroxy-4-methylpentan-2-yl)-13-(N-phenylanilino)-6,13-diazatetracyclo[6.6.2.04,16.011,15]hexadeca-1(15),2,4(16),8,10-pentaene-5,7,12,14-tetrone |
|---|---|
| PubChem CID | 118199038 |
| Molecular Formula | C32H27N3O5 |
| Molecular Weight | 533.58 g/mol |
| Exact Mass | 533.20 |
| IUPAC Name | 6-(1-hydroxy-4-methylpentan-2-yl)-13-(N-phenylanilino)-6,13-diazatetracyclo[6.6.2.04,16.011,15]hexadeca-1(15),2,4(16),8,10-pentaene-5,7,12,14-tetrone |
| SMILES | CC(C)CC(CO)N1C(=O)c2ccc3c4c(ccc(c24)C1=O)C(=O)N(N(c1ccccc1)c1ccccc1)C3=O |
| InChI | InChI=1S/C32H27N3O5/c1-19(2)17-22(18-36)33-29(37)23-13-15-25-28-26(16-14-24(27(23)28)30(33)38)32(40)35(31(25)39)34(20-9-5-3-6-10-20)21-11-7-4-8-12-21/h3-16,19,22,36H,17-18H2,1-2H3 |
| InChIKey | SQXDTCNYPOTPLS-UHFFFAOYSA-N |
| XLogP | 5.19 |
| TPSA | 98.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.58 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|