C22H24O3 — CID 118199631
(E)-3-(2,2-dimethyl-3,4-dihydrochromen-6-yl)-1-(3-methoxy-4-methylphenyl)prop-2-en-1-one (PubChem CID 118199631) has the molecular formula C22H24O3 and a molecular weight of 336.43 g/mol. Its IUPAC name is (E)-3-(2,2-dimethyl-3,4-dihydrochromen-6-yl)-1-(3-methoxy-4-methylphenyl)prop-2-en-1-one.
| Compound Name | (E)-3-(2,2-dimethyl-3,4-dihydrochromen-6-yl)-1-(3-methoxy-4-methylphenyl)prop-2-en-1-one |
|---|---|
| PubChem CID | 118199631 |
| Molecular Formula | C22H24O3 |
| Molecular Weight | 336.43 g/mol |
| Exact Mass | 336.17 |
| IUPAC Name | (E)-3-(2,2-dimethyl-3,4-dihydrochromen-6-yl)-1-(3-methoxy-4-methylphenyl)prop-2-en-1-one |
| SMILES | COc1cc(C(=O)/C=C/c2ccc3c(c2)CCC(C)(C)O3)ccc1C |
| InChI | InChI=1S/C22H24O3/c1-15-5-8-17(14-21(15)24-4)19(23)9-6-16-7-10-20-18(13-16)11-12-22(2,3)25-20/h5-10,13-14H,11-12H2,1-4H3/b9-6+ |
| InChIKey | NEJHMSZHBKUKKP-RMKNXTFCSA-N |
| XLogP | 5.00 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.43 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|