C30H22N2O10 — CID 118200383
6,13-bis[4-hydroxy-3,5-bis(hydroxymethyl)phenyl]-6,13-diazatetracyclo[6.6.2.04,16.011,15]hexadeca-1(15),2,4(16),8,10-pentaene-5,7,12,14-tetrone (PubChem CID 118200383) has the molecular formula C30H22N2O10 and a molecular weight of 570.51 g/mol. Its IUPAC name is 6,13-bis[4-hydroxy-3,5-bis(hydroxymethyl)phenyl]-6,13-diazatetracyclo[6.6.2.04,16.011,15]hexadeca-1(15),2,4(16),8,10-pentaene-5,7,12,14-tetrone.
| Compound Name | 6,13-bis[4-hydroxy-3,5-bis(hydroxymethyl)phenyl]-6,13-diazatetracyclo[6.6.2.04,16.011,15]hexadeca-1(15),2,4(16),8,10-pentaene-5,7,12,14-tetrone |
|---|---|
| PubChem CID | 118200383 |
| Molecular Formula | C30H22N2O10 |
| Molecular Weight | 570.51 g/mol |
| Exact Mass | 570.13 |
| IUPAC Name | 6,13-bis[4-hydroxy-3,5-bis(hydroxymethyl)phenyl]-6,13-diazatetracyclo[6.6.2.04,16.011,15]hexadeca-1(15),2,4(16),8,10-pentaene-5,7,12,14-tetrone |
| SMILES | O=C1c2ccc3c4c(ccc(c24)C(=O)N1c1cc(CO)c(O)c(CO)c1)C(=O)N(c1cc(CO)c(O)c(CO)c1)C3=O |
| InChI | InChI=1S/C30H22N2O10/c33-9-13-5-17(6-14(10-34)25(13)37)31-27(39)19-1-2-20-24-22(4-3-21(23(19)24)29(31)41)30(42)32(28(20)40)18-7-15(11-35)26(38)16(8-18)12-36/h1-8,33-38H,9-12H2 |
| InChIKey | CVKSMNBERKOWSG-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 196.14 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.51 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|