C12H22N8O4 — CID 118202491
3-(carbamoylamino)-1,1-bis[2-(2-oxoimidazolidin-1-yl)ethyl]urea (PubChem CID 118202491) has the molecular formula C12H22N8O4 and a molecular weight of 342.36 g/mol. Its IUPAC name is 3-(carbamoylamino)-1,1-bis[2-(2-oxoimidazolidin-1-yl)ethyl]urea.
| Compound Name | 3-(carbamoylamino)-1,1-bis[2-(2-oxoimidazolidin-1-yl)ethyl]urea |
|---|---|
| PubChem CID | 118202491 |
| Molecular Formula | C12H22N8O4 |
| Molecular Weight | 342.36 g/mol |
| Exact Mass | 342.18 |
| IUPAC Name | 3-(carbamoylamino)-1,1-bis[2-(2-oxoimidazolidin-1-yl)ethyl]urea |
| SMILES | NC(=O)NNC(=O)N(CCN1CCNC1=O)CCN1CCNC1=O |
| InChI | InChI=1S/C12H22N8O4/c13-9(21)16-17-12(24)20(7-5-18-3-1-14-10(18)22)8-6-19-4-2-15-11(19)23/h1-8H2,(H,14,22)(H,15,23)(H,17,24)(H3,13,16,21) |
| InChIKey | OEYKBVKXHHCNMK-UHFFFAOYSA-N |
| XLogP | -2.37 |
| TPSA | 152.14 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.36 |
| LogP ≤ 5 | -2.37 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|