C10H19N3O3 — CID 55206811
methyl 2-[ethyl-[2-(2-oxoimidazolidin-1-yl)ethyl]amino]acetate (PubChem CID 55206811) has the molecular formula C10H19N3O3 and a molecular weight of 229.28 g/mol. Its IUPAC name is methyl 2-[ethyl-[2-(2-oxoimidazolidin-1-yl)ethyl]amino]acetate.
| Compound Name | methyl 2-[ethyl-[2-(2-oxoimidazolidin-1-yl)ethyl]amino]acetate |
|---|---|
| PubChem CID | 55206811 |
| Molecular Formula | C10H19N3O3 |
| Molecular Weight | 229.28 g/mol |
| Exact Mass | 229.14 |
| IUPAC Name | methyl 2-[ethyl-[2-(2-oxoimidazolidin-1-yl)ethyl]amino]acetate |
| SMILES | CCN(CCN1CCNC1=O)CC(=O)OC |
| InChI | InChI=1S/C10H19N3O3/c1-3-12(8-9(14)16-2)6-7-13-5-4-11-10(13)15/h3-8H2,1-2H3,(H,11,15) |
| InChIKey | DTOQAYQXIJPBDT-UHFFFAOYSA-N |
| XLogP | -0.49 |
| TPSA | 61.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.28 |
| LogP ≤ 5 | -0.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |