C18H22BrF3N2O3 — CID 118202689
tert-butyl 4-[[2-bromo-4-(trifluoromethoxy)anilino]methyl]-3,6-dihydro-2H-pyridine-1-carboxylate (PubChem CID 118202689) has the molecular formula C18H22BrF3N2O3 and a molecular weight of 451.28 g/mol. Its IUPAC name is tert-butyl 4-[[2-bromo-4-(trifluoromethoxy)anilino]methyl]-3,6-dihydro-2H-pyridine-1-carboxylate.
| Compound Name | tert-butyl 4-[[2-bromo-4-(trifluoromethoxy)anilino]methyl]-3,6-dihydro-2H-pyridine-1-carboxylate |
|---|---|
| PubChem CID | 118202689 |
| Molecular Formula | C18H22BrF3N2O3 |
| Molecular Weight | 451.28 g/mol |
| Exact Mass | 450.08 |
| IUPAC Name | tert-butyl 4-[[2-bromo-4-(trifluoromethoxy)anilino]methyl]-3,6-dihydro-2H-pyridine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CC=C(CNc2ccc(OC(F)(F)F)cc2Br)CC1 |
| InChI | InChI=1S/C18H22BrF3N2O3/c1-17(2,3)27-16(25)24-8-6-12(7-9-24)11-23-15-5-4-13(10-14(15)19)26-18(20,21)22/h4-6,10,23H,7-9,11H2,1-3H3 |
| InChIKey | XTKUBXPKFBCXMY-UHFFFAOYSA-N |
| XLogP | 5.33 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.28 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|