C32H40N2O2 — CID 118202828
(1S,2R,16R)-5-isoquinolin-7-yl-N-(2-methoxyethyl)-N,6-dimethyl-19-oxapentacyclo[14.2.1.01,9.02,6.011,16]nonadeca-8,10-dien-14-amine (PubChem CID 118202828) has the molecular formula C32H40N2O2 and a molecular weight of 484.68 g/mol. Its IUPAC name is (1S,2R,16R)-5-isoquinolin-7-yl-N-(2-methoxyethyl)-N,6-dimethyl-19-oxapentacyclo[14.2.1.01,9.02,6.011,16]nonadeca-8,10-dien-14-amine.
| Compound Name | (1S,2R,16R)-5-isoquinolin-7-yl-N-(2-methoxyethyl)-N,6-dimethyl-19-oxapentacyclo[14.2.1.01,9.02,6.011,16]nonadeca-8,10-dien-14-amine |
|---|---|
| PubChem CID | 118202828 |
| Molecular Formula | C32H40N2O2 |
| Molecular Weight | 484.68 g/mol |
| Exact Mass | 484.31 |
| IUPAC Name | (1S,2R,16R)-5-isoquinolin-7-yl-N-(2-methoxyethyl)-N,6-dimethyl-19-oxapentacyclo[14.2.1.01,9.02,6.011,16]nonadeca-8,10-dien-14-amine |
| SMILES | COCCN(C)C1CCC2=CC3=CCC4(C)C(c5ccc6ccncc6c5)CC[C@H]4[C@@]34CC[C@]2(C1)O4 |
| InChI | InChI=1S/C32H40N2O2/c1-30-12-10-26-19-25-6-7-27(34(2)16-17-35-3)20-31(25)13-14-32(26,36-31)29(30)9-8-28(30)23-5-4-22-11-15-33-21-24(22)18-23/h4-5,10-11,15,18-19,21,27-29H,6-9,12-14,16-17,20H2,1-3H3/t27?,28?,29-,30?,31-,32-/m1/s1 |
| InChIKey | WFCDPPJZHTXBSA-XONSQYEMSA-N |
| XLogP | 6.42 |
| TPSA | 34.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.68 |
| LogP ≤ 5 | 6.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |