C39H28N4S — CID 118204248
7-cyclohexa-1,3-dien-1-yl-4-(2,6-diphenyl-1,4-dihydro-1,3,5-triazin-4-yl)-[1]benzothiolo[2,3-b]carbazole (PubChem CID 118204248) has the molecular formula C39H28N4S and a molecular weight of 584.75 g/mol. Its IUPAC name is 7-cyclohexa-1,3-dien-1-yl-4-(2,6-diphenyl-1,4-dihydro-1,3,5-triazin-4-yl)-[1]benzothiolo[2,3-b]carbazole.
| Compound Name | 7-cyclohexa-1,3-dien-1-yl-4-(2,6-diphenyl-1,4-dihydro-1,3,5-triazin-4-yl)-[1]benzothiolo[2,3-b]carbazole |
|---|---|
| PubChem CID | 118204248 |
| Molecular Formula | C39H28N4S |
| Molecular Weight | 584.75 g/mol |
| Exact Mass | 584.20 |
| IUPAC Name | 7-cyclohexa-1,3-dien-1-yl-4-(2,6-diphenyl-1,4-dihydro-1,3,5-triazin-4-yl)-[1]benzothiolo[2,3-b]carbazole |
| SMILES | C1=CCCC(n2c3ccccc3c3cc4c(cc32)sc2c(C3N=C(c5ccccc5)NC(c5ccccc5)=N3)cccc24)=C1 |
| InChI | InChI=1S/C39H28N4S/c1-4-13-25(14-5-1)37-40-38(26-15-6-2-7-16-26)42-39(41-37)30-21-12-20-29-32-23-31-28-19-10-11-22-33(28)43(27-17-8-3-9-18-27)34(31)24-35(32)44-36(29)30/h1-8,10-17,19-24,39H,9,18H2,(H,40,41,42) |
| InChIKey | IZCNRCNGBRSFEM-UHFFFAOYSA-N |
| XLogP | 9.85 |
| TPSA | 41.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.75 |
| LogP ≤ 5 | 9.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |