C50H38N6 — CID 146359307
5-[6-[2-(4-cyclohexa-1,5-dien-1-ylphenyl)-6-phenyl-1,4-dihydro-1,3,5-triazin-4-yl]-1,2-dihydropyridin-3-yl]-7-phenylindolo[2,3-b]carbazole (PubChem CID 146359307) has the molecular formula C50H38N6 and a molecular weight of 722.90 g/mol. Its IUPAC name is 5-[6-[2-(4-cyclohexa-1,5-dien-1-ylphenyl)-6-phenyl-1,4-dihydro-1,3,5-triazin-4-yl]-1,2-dihydropyridin-3-yl]-7-phenylindolo[2,3-b]carbazole.
| Compound Name | 5-[6-[2-(4-cyclohexa-1,5-dien-1-ylphenyl)-6-phenyl-1,4-dihydro-1,3,5-triazin-4-yl]-1,2-dihydropyridin-3-yl]-7-phenylindolo[2,3-b]carbazole |
|---|---|
| PubChem CID | 146359307 |
| Molecular Formula | C50H38N6 |
| Molecular Weight | 722.90 g/mol |
| Exact Mass | 722.32 |
| IUPAC Name | 5-[6-[2-(4-cyclohexa-1,5-dien-1-ylphenyl)-6-phenyl-1,4-dihydro-1,3,5-triazin-4-yl]-1,2-dihydropyridin-3-yl]-7-phenylindolo[2,3-b]carbazole |
| SMILES | C1=CC(c2ccc(C3=NC(C4=CC=C(n5c6ccccc6c6cc7c8ccccc8n(-c8ccccc8)c7cc65)CN4)N=C(c4ccccc4)N3)cc2)=CCC1 |
| InChI | InChI=1S/C50H38N6/c1-4-14-33(15-5-1)34-24-26-36(27-25-34)49-52-48(35-16-6-2-7-17-35)53-50(54-49)43-29-28-38(32-51-43)56-45-23-13-11-21-40(45)42-30-41-39-20-10-12-22-44(39)55(46(41)31-47(42)56)37-18-8-3-9-19-37/h2-4,6-31,50-51H,1,5,32H2,(H,52,53,54) |
| InChIKey | PSBSBLZCGQVTBL-UHFFFAOYSA-N |
| XLogP | 10.78 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 722.90 |
| LogP ≤ 5 | 10.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |