C25H24ClN3O5S — CID 118204706
4-tert-butyl-N-[7-chloro-2-(2-methoxy-4-methyl-3-pyridinyl)-1,3-dioxoisoindol-4-yl]benzenesulfonamide (PubChem CID 118204706) has the molecular formula C25H24ClN3O5S and a molecular weight of 514.00 g/mol. Its IUPAC name is 4-tert-butyl-N-[7-chloro-2-(2-methoxy-4-methyl-3-pyridinyl)-1,3-dioxoisoindol-4-yl]benzenesulfonamide.
| Compound Name | 4-tert-butyl-N-[7-chloro-2-(2-methoxy-4-methyl-3-pyridinyl)-1,3-dioxoisoindol-4-yl]benzenesulfonamide |
|---|---|
| PubChem CID | 118204706 |
| Molecular Formula | C25H24ClN3O5S |
| Molecular Weight | 514.00 g/mol |
| Exact Mass | 513.11 |
| IUPAC Name | 4-tert-butyl-N-[7-chloro-2-(2-methoxy-4-methyl-3-pyridinyl)-1,3-dioxoisoindol-4-yl]benzenesulfonamide |
| SMILES | COc1nccc(C)c1N1C(=O)c2c(Cl)ccc(NS(=O)(=O)c3ccc(C(C)(C)C)cc3)c2C1=O |
| InChI | InChI=1S/C25H24ClN3O5S/c1-14-12-13-27-22(34-5)21(14)29-23(30)19-17(26)10-11-18(20(19)24(29)31)28-35(32,33)16-8-6-15(7-9-16)25(2,3)4/h6-13,28H,1-5H3 |
| InChIKey | LNHMRFVTRPXWHP-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 105.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.00 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|