C10H18OS2 — CID 11820696
(2R)-2-(1,3-dithian-2-ylidenemethyl)-3-methylbutan-1-ol (PubChem CID 11820696) has the molecular formula C10H18OS2 and a molecular weight of 218.39 g/mol. Its IUPAC name is (2R)-2-(1,3-dithian-2-ylidenemethyl)-3-methylbutan-1-ol.
| Compound Name | (2R)-2-(1,3-dithian-2-ylidenemethyl)-3-methylbutan-1-ol |
|---|---|
| PubChem CID | 11820696 |
| Molecular Formula | C10H18OS2 |
| Molecular Weight | 218.39 g/mol |
| Exact Mass | 218.08 |
| IUPAC Name | (2R)-2-(1,3-dithian-2-ylidenemethyl)-3-methylbutan-1-ol |
| SMILES | CC(C)[C@H](C=C1SCCCS1)CO |
| InChI | InChI=1S/C10H18OS2/c1-8(2)9(7-11)6-10-12-4-3-5-13-10/h6,8-9,11H,3-5,7H2,1-2H3/t9-/m1/s1 |
| InChIKey | LRLVCUPCRRIZMJ-SECBINFHSA-N |
| XLogP | 2.96 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.39 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |