C8H8IN3O2 — CID 118208568
3-[(4-iodopyrazol-1-yl)methyl]pyrrolidine-2,5-dione (PubChem CID 118208568) has the molecular formula C8H8IN3O2 and a molecular weight of 305.08 g/mol. Its IUPAC name is 3-[(4-iodopyrazol-1-yl)methyl]pyrrolidine-2,5-dione.
| Compound Name | 3-[(4-iodopyrazol-1-yl)methyl]pyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 118208568 |
| Molecular Formula | C8H8IN3O2 |
| Molecular Weight | 305.08 g/mol |
| Exact Mass | 304.97 |
| IUPAC Name | 3-[(4-iodopyrazol-1-yl)methyl]pyrrolidine-2,5-dione |
| SMILES | O=C1CC(Cn2cc(I)cn2)C(=O)N1 |
| InChI | InChI=1S/C8H8IN3O2/c9-6-2-10-12(4-6)3-5-1-7(13)11-8(5)14/h2,4-5H,1,3H2,(H,11,13,14) |
| InChIKey | BSRSRVYYLTUKAV-UHFFFAOYSA-N |
| XLogP | 0.15 |
| TPSA | 63.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.08 |
| LogP ≤ 5 | 0.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|