C16H14F3N5 — CID 118208929
N-[3-methyl-5-(1-methylpyrazol-4-yl)phenyl]-4-(trifluoromethyl)pyrimidin-2-amine (PubChem CID 118208929) has the molecular formula C16H14F3N5 and a molecular weight of 333.32 g/mol. Its IUPAC name is N-[3-methyl-5-(1-methylpyrazol-4-yl)phenyl]-4-(trifluoromethyl)pyrimidin-2-amine.
| Compound Name | N-[3-methyl-5-(1-methylpyrazol-4-yl)phenyl]-4-(trifluoromethyl)pyrimidin-2-amine |
|---|---|
| PubChem CID | 118208929 |
| Molecular Formula | C16H14F3N5 |
| Molecular Weight | 333.32 g/mol |
| Exact Mass | 333.12 |
| IUPAC Name | N-[3-methyl-5-(1-methylpyrazol-4-yl)phenyl]-4-(trifluoromethyl)pyrimidin-2-amine |
| SMILES | Cc1cc(Nc2nccc(C(F)(F)F)n2)cc(-c2cnn(C)c2)c1 |
| InChI | InChI=1S/C16H14F3N5/c1-10-5-11(12-8-21-24(2)9-12)7-13(6-10)22-15-20-4-3-14(23-15)16(17,18)19/h3-9H,1-2H3,(H,20,22,23) |
| InChIKey | SOWIHCACDZWMNJ-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 55.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.32 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |