C16H13F3N6 — CID 72709972
N-[3-(2-aminopyrimidin-5-yl)-5-methylphenyl]-4-(trifluoromethyl)pyrimidin-2-amine (PubChem CID 72709972) has the molecular formula C16H13F3N6 and a molecular weight of 346.32 g/mol. Its IUPAC name is N-[3-(2-aminopyrimidin-5-yl)-5-methylphenyl]-4-(trifluoromethyl)pyrimidin-2-amine.
| Compound Name | N-[3-(2-aminopyrimidin-5-yl)-5-methylphenyl]-4-(trifluoromethyl)pyrimidin-2-amine |
|---|---|
| PubChem CID | 72709972 |
| Molecular Formula | C16H13F3N6 |
| Molecular Weight | 346.32 g/mol |
| Exact Mass | 346.12 |
| IUPAC Name | N-[3-(2-aminopyrimidin-5-yl)-5-methylphenyl]-4-(trifluoromethyl)pyrimidin-2-amine |
| SMILES | Cc1cc(Nc2nccc(C(F)(F)F)n2)cc(-c2cnc(N)nc2)c1 |
| InChI | InChI=1S/C16H13F3N6/c1-9-4-10(11-7-22-14(20)23-8-11)6-12(5-9)24-15-21-3-2-13(25-15)16(17,18)19/h2-8H,1H3,(H2,20,22,23)(H,21,24,25) |
| InChIKey | JCIFOUAZYSBZAU-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 89.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.32 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |