C19H17F3N6O — CID 135221265
[5-[3-methyl-5-[[4-(trifluoromethyl)pyrimidin-2-yl]amino]phenyl]-2-pyridinyl]methylurea (PubChem CID 135221265) has the molecular formula C19H17F3N6O and a molecular weight of 402.38 g/mol. Its IUPAC name is [5-[3-methyl-5-[[4-(trifluoromethyl)pyrimidin-2-yl]amino]phenyl]-2-pyridinyl]methylurea.
| Compound Name | [5-[3-methyl-5-[[4-(trifluoromethyl)pyrimidin-2-yl]amino]phenyl]-2-pyridinyl]methylurea |
|---|---|
| PubChem CID | 135221265 |
| Molecular Formula | C19H17F3N6O |
| Molecular Weight | 402.38 g/mol |
| Exact Mass | 402.14 |
| IUPAC Name | [5-[3-methyl-5-[[4-(trifluoromethyl)pyrimidin-2-yl]amino]phenyl]-2-pyridinyl]methylurea |
| SMILES | Cc1cc(Nc2nccc(C(F)(F)F)n2)cc(-c2ccc(CNC(N)=O)nc2)c1 |
| InChI | InChI=1S/C19H17F3N6O/c1-11-6-13(12-2-3-14(25-9-12)10-26-17(23)29)8-15(7-11)27-18-24-5-4-16(28-18)19(20,21)22/h2-9H,10H2,1H3,(H3,23,26,29)(H,24,27,28) |
| InChIKey | ZVBWPEUZELPBRC-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 105.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.38 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |